PHI 2397 Lecture Notes - Lecture 5: Categorical Imperative, Sentenced, Livent
Document Summary
Non-philosophi(cid:272)al sou(cid:396)(cid:272)es i(cid:374)ade(cid:395)uate: laws - yes, (cid:271)ut . What does it mean when you have to make a decision. It might not be adequate for normal people. It might be hard for people to not know all the laws. What"s in the law, should apply to some ethical theory: common practices - (cid:373)ay(cid:271)e, (cid:271)ut . If the others are doing it should be fine. Who will come after everyone in the practice. If you follow common practices would might be doing something unethical and illegal. Often the common practices fall under those sectors. This may often be a good thing, but it also may be questionable because there are different religions. What right and wrong varies from person to person. There is no actual way of knowing what is right in a big sense. There is no structure of what is right or wrong.