Suppose the following chemical reaction can take place in this mixture:
CH4(g)+4S(s)=CS2(g)+2H2S(g)
Knowledge Check Question 25 Sarah â¼ The drawing below shows a mixture of molecules key O carbon hydrogen O nitrogen sulfur O oxygen chlortne Ar Suppose the following chemical reaction can take place in this mixture CH4(g)-4S(s)-CS2(g) +2 H2S(g) Of which reactant are there the most initial moles? Enter its chemical formula: of which reactant are there the ieast initbal moles? Enter its chemical formula: D Which reactant is the limiting reactant? Enter its chernical formula: I Don't Know Submit 12:3
